C13H13N3O3S — CID 115285189
2-(pyridin-4-ylmethylcarbamoylamino)-2-thiophen-2-ylacetic acid (PubChem CID 115285189) has the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. Its IUPAC name is 2-(pyridin-4-ylmethylcarbamoylamino)-2-thiophen-2-ylacetic acid.
| Compound Name | 2-(pyridin-4-ylmethylcarbamoylamino)-2-thiophen-2-ylacetic acid |
|---|---|
| PubChem CID | 115285189 |
| Molecular Formula | C13H13N3O3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2-(pyridin-4-ylmethylcarbamoylamino)-2-thiophen-2-ylacetic acid |
| SMILES | O=C(NCc1ccncc1)NC(C(=O)O)c1cccs1 |
| InChI | InChI=1S/C13H13N3O3S/c17-12(18)11(10-2-1-7-20-10)16-13(19)15-8-9-3-5-14-6-4-9/h1-7,11H,8H2,(H,17,18)(H2,15,16,19) |
| InChIKey | UZANFJNFJQYDQZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |