C9H13N3O3S — CID 54530029
2-(dimethylaminocarbamoylamino)-2-thiophen-2-ylacetic acid (PubChem CID 54530029) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is 2-(dimethylaminocarbamoylamino)-2-thiophen-2-ylacetic acid.
| Compound Name | 2-(dimethylaminocarbamoylamino)-2-thiophen-2-ylacetic acid |
|---|---|
| PubChem CID | 54530029 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2-(dimethylaminocarbamoylamino)-2-thiophen-2-ylacetic acid |
| SMILES | CN(C)NC(=O)NC(C(=O)O)c1cccs1 |
| InChI | InChI=1S/C9H13N3O3S/c1-12(2)11-9(15)10-7(8(13)14)6-4-3-5-16-6/h3-5,7H,1-2H3,(H,13,14)(H2,10,11,15) |
| InChIKey | YVWBLVSHDSUKTQ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|