C12H18N2O3S — CID 113278882
2-[[ethyl(propyl)carbamoyl]amino]-2-thiophen-2-ylacetic acid (PubChem CID 113278882) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 2-[[ethyl(propyl)carbamoyl]amino]-2-thiophen-2-ylacetic acid.
| Compound Name | 2-[[ethyl(propyl)carbamoyl]amino]-2-thiophen-2-ylacetic acid |
|---|---|
| PubChem CID | 113278882 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-[[ethyl(propyl)carbamoyl]amino]-2-thiophen-2-ylacetic acid |
| SMILES | CCCN(CC)C(=O)NC(C(=O)O)c1cccs1 |
| InChI | InChI=1S/C12H18N2O3S/c1-3-7-14(4-2)12(17)13-10(11(15)16)9-6-5-8-18-9/h5-6,8,10H,3-4,7H2,1-2H3,(H,13,17)(H,15,16) |
| InChIKey | YVVFQDIPRSRHFB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |