C8H8N2O4S — CID 70554703
(2R)-2-(oxamoylamino)-2-thiophen-2-ylacetic acid (PubChem CID 70554703) has the molecular formula C8H8N2O4S and a molecular weight of 228.23 g/mol. Its IUPAC name is (2R)-2-(oxamoylamino)-2-thiophen-2-ylacetic acid.
| Compound Name | (2R)-2-(oxamoylamino)-2-thiophen-2-ylacetic acid |
|---|---|
| PubChem CID | 70554703 |
| Molecular Formula | C8H8N2O4S |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | (2R)-2-(oxamoylamino)-2-thiophen-2-ylacetic acid |
| SMILES | NC(=O)C(=O)N[C@H](C(=O)O)c1cccs1 |
| InChI | InChI=1S/C8H8N2O4S/c9-6(11)7(12)10-5(8(13)14)4-2-1-3-15-4/h1-3,5H,(H2,9,11)(H,10,12)(H,13,14)/t5-/m0/s1 |
| InChIKey | CXPWSYLIIDGPCQ-YFKPBYRVSA-N |
| XLogP | -0.52 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|