C8H17O3SSn — CID 173446533
CID 173446533 (PubChem CID 173446533) has the molecular formula C8H17O3SSn and a molecular weight of 312.00 g/mol.
| Compound Name | CID 173446533 |
|---|---|
| PubChem CID | 173446533 |
| Molecular Formula | C8H17O3SSn |
| Molecular Weight | 312.00 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | — |
| SMILES | C=CCSC(O)C(=O)O.C[Sn](C)C |
| InChI | InChI=1S/C5H8O3S.3CH3.Sn/c1-2-3-9-5(8)4(6)7;;;;/h2,5,8H,1,3H2,(H,6,7);3*1H3; |
| InChIKey | WLYVCMVFZPXFAF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.00 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|