C8H15NO2S — CID 13127849
(2S)-2-amino-3-methyl-3-prop-2-enylsulfanylbutanoic acid (PubChem CID 13127849) has the molecular formula C8H15NO2S and a molecular weight of 189.28 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-3-prop-2-enylsulfanylbutanoic acid.
| Compound Name | (2S)-2-amino-3-methyl-3-prop-2-enylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 13127849 |
| Molecular Formula | C8H15NO2S |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | (2S)-2-amino-3-methyl-3-prop-2-enylsulfanylbutanoic acid |
| SMILES | C=CCSC(C)(C)[C@@H](N)C(=O)O |
| InChI | InChI=1S/C8H15NO2S/c1-4-5-12-8(2,3)6(9)7(10)11/h4,6H,1,5,9H2,2-3H3,(H,10,11)/t6-/m0/s1 |
| InChIKey | PESPDFRKSAGSLL-LURJTMIESA-N |
| XLogP | 1.10 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|