C10H21NO3S — CID 106443558
(2S)-2-amino-3-(3-hydroxy-3-methylbutyl)sulfanyl-3-methylbutanoic acid (PubChem CID 106443558) has the molecular formula C10H21NO3S and a molecular weight of 235.35 g/mol. Its IUPAC name is (2S)-2-amino-3-(3-hydroxy-3-methylbutyl)sulfanyl-3-methylbutanoic acid.
| Compound Name | (2S)-2-amino-3-(3-hydroxy-3-methylbutyl)sulfanyl-3-methylbutanoic acid |
|---|---|
| PubChem CID | 106443558 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (2S)-2-amino-3-(3-hydroxy-3-methylbutyl)sulfanyl-3-methylbutanoic acid |
| SMILES | CC(C)(O)CCSC(C)(C)[C@@H](N)C(=O)O |
| InChI | InChI=1S/C10H21NO3S/c1-9(2,14)5-6-15-10(3,4)7(11)8(12)13/h7,14H,5-6,11H2,1-4H3,(H,12,13)/t7-/m0/s1 |
| InChIKey | ZOCKQBVPXNFEHP-ZETCQYMHSA-N |
| XLogP | 1.07 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |