C9H18N2O3S — CID 106442600
(2R)-2-amino-3-[2-(dimethylamino)-2-oxoethyl]sulfanyl-3-methylbutanoic acid (PubChem CID 106442600) has the molecular formula C9H18N2O3S and a molecular weight of 234.32 g/mol. Its IUPAC name is (2R)-2-amino-3-[2-(dimethylamino)-2-oxoethyl]sulfanyl-3-methylbutanoic acid.
| Compound Name | (2R)-2-amino-3-[2-(dimethylamino)-2-oxoethyl]sulfanyl-3-methylbutanoic acid |
|---|---|
| PubChem CID | 106442600 |
| Molecular Formula | C9H18N2O3S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | (2R)-2-amino-3-[2-(dimethylamino)-2-oxoethyl]sulfanyl-3-methylbutanoic acid |
| SMILES | CN(C)C(=O)CSC(C)(C)[C@H](N)C(=O)O |
| InChI | InChI=1S/C9H18N2O3S/c1-9(2,7(10)8(13)14)15-5-6(12)11(3)4/h7H,5,10H2,1-4H3,(H,13,14)/t7-/m1/s1 |
| InChIKey | RUHAUPCPSSXROC-SSDOTTSWSA-N |
| XLogP | -0.00 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |