C12H18S2 — CID 10962296
2,5-bis(prop-2-enylsulfanyl)hex-3-yne (PubChem CID 10962296) has the molecular formula C12H18S2 and a molecular weight of 226.41 g/mol. Its IUPAC name is 2,5-bis(prop-2-enylsulfanyl)hex-3-yne.
| Compound Name | 2,5-bis(prop-2-enylsulfanyl)hex-3-yne |
|---|---|
| PubChem CID | 10962296 |
| Molecular Formula | C12H18S2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2,5-bis(prop-2-enylsulfanyl)hex-3-yne |
| SMILES | C=CCSC(C)C#CC(C)SCC=C |
| InChI | InChI=1S/C12H18S2/c1-5-9-13-11(3)7-8-12(4)14-10-6-2/h5-6,11-12H,1-2,9-10H2,3-4H3 |
| InChIKey | XCBDWNDEAPEYGQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|