C13H21NO5S — CID 122197275
(E,2R)-5-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-2-propylpent-3-enoic acid (PubChem CID 122197275) has the molecular formula C13H21NO5S and a molecular weight of 303.38 g/mol. Its IUPAC name is (E,2R)-5-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-2-propylpent-3-enoic acid.
| Compound Name | (E,2R)-5-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-2-propylpent-3-enoic acid |
|---|---|
| PubChem CID | 122197275 |
| Molecular Formula | C13H21NO5S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (E,2R)-5-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-2-propylpent-3-enoic acid |
| SMILES | CCC[C@H](/C=C/CSC[C@H](NC(C)=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C13H21NO5S/c1-3-5-10(12(16)17)6-4-7-20-8-11(13(18)19)14-9(2)15/h4,6,10-11H,3,5,7-8H2,1-2H3,(H,14,15)(H,16,17)(H,18,19)/b6-4+/t10-,11+/m1/s1 |
| InChIKey | YQPSXCCXWFQDBZ-MRUFAENASA-N |
| XLogP | 1.37 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|