C8H17N3O2S — CID 167237972
(2S)-N-(2-acetamidoethylsulfanylmethyl)-2-aminopropanamide (PubChem CID 167237972) has the molecular formula C8H17N3O2S and a molecular weight of 219.31 g/mol. Its IUPAC name is (2S)-N-(2-acetamidoethylsulfanylmethyl)-2-aminopropanamide.
| Compound Name | (2S)-N-(2-acetamidoethylsulfanylmethyl)-2-aminopropanamide |
|---|---|
| PubChem CID | 167237972 |
| Molecular Formula | C8H17N3O2S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | (2S)-N-(2-acetamidoethylsulfanylmethyl)-2-aminopropanamide |
| SMILES | CC(=O)NCCSCNC(=O)[C@H](C)N |
| InChI | InChI=1S/C8H17N3O2S/c1-6(9)8(13)11-5-14-4-3-10-7(2)12/h6H,3-5,9H2,1-2H3,(H,10,12)(H,11,13)/t6-/m0/s1 |
| InChIKey | HEUQYLLHUNNAHN-LURJTMIESA-N |
| XLogP | -0.72 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|