C5H11FN2O — CID 90216538
(2R)-2-amino-N-(2-fluoroethyl)propanamide (PubChem CID 90216538) has the molecular formula C5H11FN2O and a molecular weight of 134.15 g/mol. Its IUPAC name is (2R)-2-amino-N-(2-fluoroethyl)propanamide.
| Compound Name | (2R)-2-amino-N-(2-fluoroethyl)propanamide |
|---|---|
| PubChem CID | 90216538 |
| Molecular Formula | C5H11FN2O |
| Molecular Weight | 134.15 g/mol |
| Exact Mass | 134.09 |
| IUPAC Name | (2R)-2-amino-N-(2-fluoroethyl)propanamide |
| SMILES | C[C@@H](N)C(=O)NCCF |
| InChI | InChI=1S/C5H11FN2O/c1-4(7)5(9)8-3-2-6/h4H,2-3,7H2,1H3,(H,8,9)/t4-/m1/s1 |
| InChIKey | ZSGXAUORGBEYFK-SCSAIBSYSA-N |
| XLogP | -0.58 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.15 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |