C6H12N2O3S — CID 87664921
(2S)-2-amino-3-(1-amino-2-oxopropyl)sulfanylpropanoic acid (PubChem CID 87664921) has the molecular formula C6H12N2O3S and a molecular weight of 192.24 g/mol. Its IUPAC name is (2S)-2-amino-3-(1-amino-2-oxopropyl)sulfanylpropanoic acid.
| Compound Name | (2S)-2-amino-3-(1-amino-2-oxopropyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 87664921 |
| Molecular Formula | C6H12N2O3S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | (2S)-2-amino-3-(1-amino-2-oxopropyl)sulfanylpropanoic acid |
| SMILES | CC(=O)C(N)SC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C6H12N2O3S/c1-3(9)5(8)12-2-4(7)6(10)11/h4-5H,2,7-8H2,1H3,(H,10,11)/t4-,5?/m1/s1 |
| InChIKey | QGVFBJXHHBYEKD-CNZKWPKMSA-N |
| XLogP | -0.99 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|