C6H14I2N2O2S — CID 159887720
2-amino-3-(1-aminopropan-2-ylsulfanyl)propanoic acid;molecular iodine (PubChem CID 159887720) has the molecular formula C6H14I2N2O2S and a molecular weight of 432.07 g/mol. Its IUPAC name is 2-amino-3-(1-aminopropan-2-ylsulfanyl)propanoic acid;molecular iodine.
| Compound Name | 2-amino-3-(1-aminopropan-2-ylsulfanyl)propanoic acid;molecular iodine |
|---|---|
| PubChem CID | 159887720 |
| Molecular Formula | C6H14I2N2O2S |
| Molecular Weight | 432.07 g/mol |
| Exact Mass | 431.89 |
| IUPAC Name | 2-amino-3-(1-aminopropan-2-ylsulfanyl)propanoic acid;molecular iodine |
| SMILES | CC(CN)SCC(N)C(=O)O.II |
| InChI | InChI=1S/C6H14N2O2S.I2/c1-4(2-7)11-3-5(8)6(9)10;1-2/h4-5H,2-3,7-8H2,1H3,(H,9,10); |
| InChIKey | NUIQVJNTTAMGBW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.07 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|