About propan-2-yl 2-(1-aminopropan-2-ylsulfanyl)acetate
propan-2-yl 2-(1-aminopropan-2-ylsulfanyl)acetate (PubChem CID 66241823) has the molecular formula C8H17NO2S
and a molecular weight of 191.30 g/mol. Its IUPAC name is propan-2-yl 2-(1-aminopropan-2-ylsulfanyl)acetate.
Molecular Properties
| Compound Name | propan-2-yl 2-(1-aminopropan-2-ylsulfanyl)acetate |
| PubChem CID | 66241823 |
| Molecular Formula | C8H17NO2S |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.10 |
| IUPAC Name | propan-2-yl 2-(1-aminopropan-2-ylsulfanyl)acetate |
| SMILES | CC(C)OC(=O)CSC(C)CN |
| InChI | InChI=1S/C8H17NO2S/c1-6(2)11-8(10)5-12-7(3)4-9/h6-7H,4-5,9H2,1-3H3 |
| InChIKey | ZAIIYHHFOULAGQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propan-2-yl 2-(1-aminopropan-2-ylsulfanyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-(1-aminopropan-2-ylsulfanyl)acetate?
The IUPAC name of propan-2-yl 2-(1-aminopropan-2-ylsulfanyl)acetate (CID 66241823) is propan-2-yl 2-(1-aminopropan-2-ylsulfanyl)acetate.
What is the SMILES notation for propan-2-yl 2-(1-aminopropan-2-ylsulfanyl)acetate?
The canonical SMILES for propan-2-yl 2-(1-aminopropan-2-ylsulfanyl)acetate is CC(C)OC(=O)CSC(C)CN.
What is the InChIKey of propan-2-yl 2-(1-aminopropan-2-ylsulfanyl)acetate?
The InChIKey is ZAIIYHHFOULAGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2S/c1-6(2)11-8(10)5-12-7(3)4-9/h6-7H,4-5,9H2,1-3H3.
What are the key properties of propan-2-yl 2-(1-aminopropan-2-ylsulfanyl)acetate?
propan-2-yl 2-(1-aminopropan-2-ylsulfanyl)acetate has a molecular weight of 191.30 g/mol, XLogP of 1.02, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-(1-aminopropan-2-ylsulfanyl)acetate is sourced from PubChem (CID 66241823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).