C6H13N3O2S — CID 66218622
2-(1-aminopropan-2-ylsulfanyl)-N-carbamoylacetamide (PubChem CID 66218622) has the molecular formula C6H13N3O2S and a molecular weight of 191.26 g/mol. Its IUPAC name is 2-(1-aminopropan-2-ylsulfanyl)-N-carbamoylacetamide.
| Compound Name | 2-(1-aminopropan-2-ylsulfanyl)-N-carbamoylacetamide |
|---|---|
| PubChem CID | 66218622 |
| Molecular Formula | C6H13N3O2S |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 2-(1-aminopropan-2-ylsulfanyl)-N-carbamoylacetamide |
| SMILES | CC(CN)SCC(=O)NC(N)=O |
| InChI | InChI=1S/C6H13N3O2S/c1-4(2-7)12-3-5(10)9-6(8)11/h4H,2-3,7H2,1H3,(H3,8,9,10,11) |
| InChIKey | SYZJLGJOXJEBRK-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |