C10H16N4OS — CID 66244360
2-(1-aminopropan-2-ylsulfanyl)-N'-pyridin-2-ylacetohydrazide (PubChem CID 66244360) has the molecular formula C10H16N4OS and a molecular weight of 240.33 g/mol. Its IUPAC name is 2-(1-aminopropan-2-ylsulfanyl)-N'-pyridin-2-ylacetohydrazide.
| Compound Name | 2-(1-aminopropan-2-ylsulfanyl)-N'-pyridin-2-ylacetohydrazide |
|---|---|
| PubChem CID | 66244360 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-(1-aminopropan-2-ylsulfanyl)-N'-pyridin-2-ylacetohydrazide |
| SMILES | CC(CN)SCC(=O)NNc1ccccn1 |
| InChI | InChI=1S/C10H16N4OS/c1-8(6-11)16-7-10(15)14-13-9-4-2-3-5-12-9/h2-5,8H,6-7,11H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | USTXTUVSNHEEGO-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|