C11H16N4O3 — CID 79410241
2-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-N'-pyridin-2-ylacetohydrazide (PubChem CID 79410241) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-N'-pyridin-2-ylacetohydrazide.
| Compound Name | 2-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-N'-pyridin-2-ylacetohydrazide |
|---|---|
| PubChem CID | 79410241 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-N'-pyridin-2-ylacetohydrazide |
| SMILES | O=C(CN1C[C@@H](O)[C@@H](O)C1)NNc1ccccn1 |
| InChI | InChI=1S/C11H16N4O3/c16-8-5-15(6-9(8)17)7-11(18)14-13-10-3-1-2-4-12-10/h1-4,8-9,16-17H,5-7H2,(H,12,13)(H,14,18)/t8-,9+ |
| InChIKey | VUECDCNDTBTNAR-DTORHVGOSA-N |
| XLogP | -1.44 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|