C14H22N4O3 — CID 82684328
2-[4-(2-hydroxyethoxy)piperidin-1-yl]-N'-pyridin-2-ylacetohydrazide (PubChem CID 82684328) has the molecular formula C14H22N4O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-[4-(2-hydroxyethoxy)piperidin-1-yl]-N'-pyridin-2-ylacetohydrazide.
| Compound Name | 2-[4-(2-hydroxyethoxy)piperidin-1-yl]-N'-pyridin-2-ylacetohydrazide |
|---|---|
| PubChem CID | 82684328 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-[4-(2-hydroxyethoxy)piperidin-1-yl]-N'-pyridin-2-ylacetohydrazide |
| SMILES | O=C(CN1CCC(OCCO)CC1)NNc1ccccn1 |
| InChI | InChI=1S/C14H22N4O3/c19-9-10-21-12-4-7-18(8-5-12)11-14(20)17-16-13-3-1-2-6-15-13/h1-3,6,12,19H,4-5,7-11H2,(H,15,16)(H,17,20) |
| InChIKey | REDJLVCTIBXVFS-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|