C9H19N3O3 — CID 82701189
2-[4-(2-hydroxyethoxy)piperidin-1-yl]acetohydrazide (PubChem CID 82701189) has the molecular formula C9H19N3O3 and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-[4-(2-hydroxyethoxy)piperidin-1-yl]acetohydrazide.
| Compound Name | 2-[4-(2-hydroxyethoxy)piperidin-1-yl]acetohydrazide |
|---|---|
| PubChem CID | 82701189 |
| Molecular Formula | C9H19N3O3 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | 2-[4-(2-hydroxyethoxy)piperidin-1-yl]acetohydrazide |
| SMILES | NNC(=O)CN1CCC(OCCO)CC1 |
| InChI | InChI=1S/C9H19N3O3/c10-11-9(14)7-12-3-1-8(2-4-12)15-6-5-13/h8,13H,1-7,10H2,(H,11,14) |
| InChIKey | XGNWBFDGHRCHIJ-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|