C8H17N5O2 — CID 3282644
1-(2-hydrazinyl-2-oxoethyl)piperidine-4-carbohydrazide (PubChem CID 3282644) has the molecular formula C8H17N5O2 and a molecular weight of 215.26 g/mol. Its IUPAC name is 1-(2-hydrazinyl-2-oxoethyl)piperidine-4-carbohydrazide.
| Compound Name | 1-(2-hydrazinyl-2-oxoethyl)piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 3282644 |
| Molecular Formula | C8H17N5O2 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 1-(2-hydrazinyl-2-oxoethyl)piperidine-4-carbohydrazide |
| SMILES | NNC(=O)CN1CCC(C(=O)NN)CC1 |
| InChI | InChI=1S/C8H17N5O2/c9-11-7(14)5-13-3-1-6(2-4-13)8(15)12-10/h6H,1-5,9-10H2,(H,11,14)(H,12,15) |
| InChIKey | UAEIHZSOMFFTBE-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|