C8H16N4O2 — CID 63568809
1-(2-hydrazinyl-2-oxoethyl)piperidine-4-carboxamide (PubChem CID 63568809) has the molecular formula C8H16N4O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is 1-(2-hydrazinyl-2-oxoethyl)piperidine-4-carboxamide.
| Compound Name | 1-(2-hydrazinyl-2-oxoethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 63568809 |
| Molecular Formula | C8H16N4O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 1-(2-hydrazinyl-2-oxoethyl)piperidine-4-carboxamide |
| SMILES | NNC(=O)CN1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C8H16N4O2/c9-8(14)6-1-3-12(4-2-6)5-7(13)11-10/h6H,1-5,10H2,(H2,9,14)(H,11,13) |
| InChIKey | SHKXWCFJCGNCTA-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|