C13H27N3O2 — CID 82693750
2-[4-(2-aminoethoxy)piperidin-1-yl]-N-tert-butylacetamide (PubChem CID 82693750) has the molecular formula C13H27N3O2 and a molecular weight of 257.38 g/mol. Its IUPAC name is 2-[4-(2-aminoethoxy)piperidin-1-yl]-N-tert-butylacetamide.
| Compound Name | 2-[4-(2-aminoethoxy)piperidin-1-yl]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 82693750 |
| Molecular Formula | C13H27N3O2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 2-[4-(2-aminoethoxy)piperidin-1-yl]-N-tert-butylacetamide |
| SMILES | CC(C)(C)NC(=O)CN1CCC(OCCN)CC1 |
| InChI | InChI=1S/C13H27N3O2/c1-13(2,3)15-12(17)10-16-7-4-11(5-8-16)18-9-6-14/h11H,4-10,14H2,1-3H3,(H,15,17) |
| InChIKey | WZKNNOQNSWZFEJ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |