C10H14N4O2 — CID 63282140
2-(3-hydroxyazetidin-1-yl)-N'-pyridin-2-ylacetohydrazide (PubChem CID 63282140) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 2-(3-hydroxyazetidin-1-yl)-N'-pyridin-2-ylacetohydrazide.
| Compound Name | 2-(3-hydroxyazetidin-1-yl)-N'-pyridin-2-ylacetohydrazide |
|---|---|
| PubChem CID | 63282140 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 2-(3-hydroxyazetidin-1-yl)-N'-pyridin-2-ylacetohydrazide |
| SMILES | O=C(CN1CC(O)C1)NNc1ccccn1 |
| InChI | InChI=1S/C10H14N4O2/c15-8-5-14(6-8)7-10(16)13-12-9-3-1-2-4-11-9/h1-4,8,15H,5-7H2,(H,11,12)(H,13,16) |
| InChIKey | SROWVTGYYLLTJQ-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|