C12H15BrN2O3 — CID 106673025
N-(2-bromophenyl)-2-(3,4-dihydroxypyrrolidin-1-yl)acetamide (PubChem CID 106673025) has the molecular formula C12H15BrN2O3 and a molecular weight of 315.17 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-(3,4-dihydroxypyrrolidin-1-yl)acetamide.
| Compound Name | N-(2-bromophenyl)-2-(3,4-dihydroxypyrrolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 106673025 |
| Molecular Formula | C12H15BrN2O3 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | N-(2-bromophenyl)-2-(3,4-dihydroxypyrrolidin-1-yl)acetamide |
| SMILES | O=C(CN1CC(O)C(O)C1)Nc1ccccc1Br |
| InChI | InChI=1S/C12H15BrN2O3/c13-8-3-1-2-4-9(8)14-12(18)7-15-5-10(16)11(17)6-15/h1-4,10-11,16-17H,5-7H2,(H,14,18) |
| InChIKey | LTOKTXOCTCMKTB-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |