C18H19BrN2O — CID 95785992
N-(2-bromophenyl)-2-[(2S,3S)-3-methyl-2-phenylazetidin-1-yl]acetamide (PubChem CID 95785992) has the molecular formula C18H19BrN2O and a molecular weight of 359.27 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-[(2S,3S)-3-methyl-2-phenylazetidin-1-yl]acetamide.
| Compound Name | N-(2-bromophenyl)-2-[(2S,3S)-3-methyl-2-phenylazetidin-1-yl]acetamide |
|---|---|
| PubChem CID | 95785992 |
| Molecular Formula | C18H19BrN2O |
| Molecular Weight | 359.27 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | N-(2-bromophenyl)-2-[(2S,3S)-3-methyl-2-phenylazetidin-1-yl]acetamide |
| SMILES | C[C@H]1CN(CC(=O)Nc2ccccc2Br)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H19BrN2O/c1-13-11-21(18(13)14-7-3-2-4-8-14)12-17(22)20-16-10-6-5-9-15(16)19/h2-10,13,18H,11-12H2,1H3,(H,20,22)/t13-,18-/m0/s1 |
| InChIKey | ZILRSSYPLXJXMK-UGSOOPFHSA-N |
| XLogP | 4.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.27 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |