C10H20N2O4S — CID 57257580
2-amino-3-[(2S)-2-carboxy-2-(diethylamino)ethyl]sulfanylpropanoic acid (PubChem CID 57257580) has the molecular formula C10H20N2O4S and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-amino-3-[(2S)-2-carboxy-2-(diethylamino)ethyl]sulfanylpropanoic acid.
| Compound Name | 2-amino-3-[(2S)-2-carboxy-2-(diethylamino)ethyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 57257580 |
| Molecular Formula | C10H20N2O4S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-amino-3-[(2S)-2-carboxy-2-(diethylamino)ethyl]sulfanylpropanoic acid |
| SMILES | CCN(CC)[C@H](CSCC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H20N2O4S/c1-3-12(4-2)8(10(15)16)6-17-5-7(11)9(13)14/h7-8H,3-6,11H2,1-2H3,(H,13,14)(H,15,16)/t7?,8-/m1/s1 |
| InChIKey | FDTIZNGEZNQUBT-BRFYHDHCSA-N |
| XLogP | -0.07 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |