C11H19NO5S — CID 163907532
[(2R)-2-acetyloxy-3-[(2R)-2-amino-3-oxobutyl]sulfanylpropyl] acetate (PubChem CID 163907532) has the molecular formula C11H19NO5S and a molecular weight of 277.34 g/mol. Its IUPAC name is [(2R)-2-acetyloxy-3-[(2R)-2-amino-3-oxobutyl]sulfanylpropyl] acetate.
| Compound Name | [(2R)-2-acetyloxy-3-[(2R)-2-amino-3-oxobutyl]sulfanylpropyl] acetate |
|---|---|
| PubChem CID | 163907532 |
| Molecular Formula | C11H19NO5S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | [(2R)-2-acetyloxy-3-[(2R)-2-amino-3-oxobutyl]sulfanylpropyl] acetate |
| SMILES | CC(=O)OC[C@H](CSC[C@H](N)C(C)=O)OC(C)=O |
| InChI | InChI=1S/C11H19NO5S/c1-7(13)11(12)6-18-5-10(17-9(3)15)4-16-8(2)14/h10-11H,4-6,12H2,1-3H3/t10-,11+/m1/s1 |
| InChIKey | QPGVRKZQTQEJOE-MNOVXSKESA-N |
| XLogP | 0.13 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |