C16H31N2O10PS — CID 88591237
2-[2-[2-[[(2R)-2-amino-3-[(2R)-2,3-diacetyloxypropyl]sulfanylpropanoyl]amino]ethoxy]ethoxy]ethylphosphonic acid (PubChem CID 88591237) has the molecular formula C16H31N2O10PS and a molecular weight of 474.47 g/mol. Its IUPAC name is 2-[2-[2-[[(2R)-2-amino-3-[(2R)-2,3-diacetyloxypropyl]sulfanylpropanoyl]amino]ethoxy]ethoxy]ethylphosphonic acid.
| Compound Name | 2-[2-[2-[[(2R)-2-amino-3-[(2R)-2,3-diacetyloxypropyl]sulfanylpropanoyl]amino]ethoxy]ethoxy]ethylphosphonic acid |
|---|---|
| PubChem CID | 88591237 |
| Molecular Formula | C16H31N2O10PS |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 2-[2-[2-[[(2R)-2-amino-3-[(2R)-2,3-diacetyloxypropyl]sulfanylpropanoyl]amino]ethoxy]ethoxy]ethylphosphonic acid |
| SMILES | CC(=O)OC[C@H](CSC[C@H](N)C(=O)NCCOCCOCCP(=O)(O)O)OC(C)=O |
| InChI | InChI=1S/C16H31N2O10PS/c1-12(19)27-9-14(28-13(2)20)10-30-11-15(17)16(21)18-3-4-25-5-6-26-7-8-29(22,23)24/h14-15H,3-11,17H2,1-2H3,(H,18,21)(H2,22,23,24)/t14-,15+/m1/s1 |
| InChIKey | KGZDVVACTIPKFR-CABCVRRESA-N |
| XLogP | -1.13 |
| TPSA | 183.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|