C15H29N3O5S — CID 89435143
[(2R)-2-acetyloxy-3-[(2R)-2-amino-3-(5-aminopentylamino)-3-oxopropyl]sulfanylpropyl] acetate (PubChem CID 89435143) has the molecular formula C15H29N3O5S and a molecular weight of 363.48 g/mol. Its IUPAC name is [(2R)-2-acetyloxy-3-[(2R)-2-amino-3-(5-aminopentylamino)-3-oxopropyl]sulfanylpropyl] acetate.
| Compound Name | [(2R)-2-acetyloxy-3-[(2R)-2-amino-3-(5-aminopentylamino)-3-oxopropyl]sulfanylpropyl] acetate |
|---|---|
| PubChem CID | 89435143 |
| Molecular Formula | C15H29N3O5S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | [(2R)-2-acetyloxy-3-[(2R)-2-amino-3-(5-aminopentylamino)-3-oxopropyl]sulfanylpropyl] acetate |
| SMILES | CC(=O)OC[C@H](CSC[C@H](N)C(=O)NCCCCCN)OC(C)=O |
| InChI | InChI=1S/C15H29N3O5S/c1-11(19)22-8-13(23-12(2)20)9-24-10-14(17)15(21)18-7-5-3-4-6-16/h13-14H,3-10,16-17H2,1-2H3,(H,18,21)/t13-,14+/m1/s1 |
| InChIKey | HOGDSHZLWNAXJL-KGLIPLIRSA-N |
| XLogP | -0.21 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|