C21H33N2O9PS — CID 77410480
3-[4-[2-[[2-amino-3-(2,3-diacetyloxypropylsulfanyl)propanoyl]amino]ethyl]phenoxy]propylphosphonic acid (PubChem CID 77410480) has the molecular formula C21H33N2O9PS and a molecular weight of 520.54 g/mol. Its IUPAC name is 3-[4-[2-[[2-amino-3-(2,3-diacetyloxypropylsulfanyl)propanoyl]amino]ethyl]phenoxy]propylphosphonic acid.
| Compound Name | 3-[4-[2-[[2-amino-3-(2,3-diacetyloxypropylsulfanyl)propanoyl]amino]ethyl]phenoxy]propylphosphonic acid |
|---|---|
| PubChem CID | 77410480 |
| Molecular Formula | C21H33N2O9PS |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | 3-[4-[2-[[2-amino-3-(2,3-diacetyloxypropylsulfanyl)propanoyl]amino]ethyl]phenoxy]propylphosphonic acid |
| SMILES | CC(=O)OCC(CSCC(N)C(=O)NCCc1ccc(OCCCP(=O)(O)O)cc1)OC(C)=O |
| InChI | InChI=1S/C21H33N2O9PS/c1-15(24)31-12-19(32-16(2)25)13-34-14-20(22)21(26)23-9-8-17-4-6-18(7-5-17)30-10-3-11-33(27,28)29/h4-7,19-20H,3,8-14,22H2,1-2H3,(H,23,26)(H2,27,28,29) |
| InChIKey | QLJGJRVAKPTXMV-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 174.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|