C13H25N2O8PS — CID 88591235
3-[[(2R)-2-amino-3-[(2R)-2,3-diacetyloxypropyl]sulfanylpropanoyl]amino]propylphosphonic acid (PubChem CID 88591235) has the molecular formula C13H25N2O8PS and a molecular weight of 400.39 g/mol. Its IUPAC name is 3-[[(2R)-2-amino-3-[(2R)-2,3-diacetyloxypropyl]sulfanylpropanoyl]amino]propylphosphonic acid.
| Compound Name | 3-[[(2R)-2-amino-3-[(2R)-2,3-diacetyloxypropyl]sulfanylpropanoyl]amino]propylphosphonic acid |
|---|---|
| PubChem CID | 88591235 |
| Molecular Formula | C13H25N2O8PS |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 3-[[(2R)-2-amino-3-[(2R)-2,3-diacetyloxypropyl]sulfanylpropanoyl]amino]propylphosphonic acid |
| SMILES | CC(=O)OC[C@H](CSC[C@H](N)C(=O)NCCCP(=O)(O)O)OC(C)=O |
| InChI | InChI=1S/C13H25N2O8PS/c1-9(16)22-6-11(23-10(2)17)7-25-8-12(14)13(18)15-4-3-5-24(19,20)21/h11-12H,3-8,14H2,1-2H3,(H,15,18)(H2,19,20,21)/t11-,12+/m1/s1 |
| InChIKey | YQATVVUKFOCHAK-NEPJUHHUSA-N |
| XLogP | -0.77 |
| TPSA | 165.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|