C16H35N2O9PS — CID 89434926
2-[2-[2-[2-[[(2R)-2-amino-3-[(2R)-2,3-dimethoxypropyl]sulfanylpropanoyl]amino]ethoxy]ethoxy]ethoxy]ethylphosphonic acid (PubChem CID 89434926) has the molecular formula C16H35N2O9PS and a molecular weight of 462.50 g/mol. Its IUPAC name is 2-[2-[2-[2-[[(2R)-2-amino-3-[(2R)-2,3-dimethoxypropyl]sulfanylpropanoyl]amino]ethoxy]ethoxy]ethoxy]ethylphosphonic acid.
| Compound Name | 2-[2-[2-[2-[[(2R)-2-amino-3-[(2R)-2,3-dimethoxypropyl]sulfanylpropanoyl]amino]ethoxy]ethoxy]ethoxy]ethylphosphonic acid |
|---|---|
| PubChem CID | 89434926 |
| Molecular Formula | C16H35N2O9PS |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 2-[2-[2-[2-[[(2R)-2-amino-3-[(2R)-2,3-dimethoxypropyl]sulfanylpropanoyl]amino]ethoxy]ethoxy]ethoxy]ethylphosphonic acid |
| SMILES | COC[C@H](CSC[C@H](N)C(=O)NCCOCCOCCOCCP(=O)(O)O)OC |
| InChI | InChI=1S/C16H35N2O9PS/c1-23-11-14(24-2)12-29-13-15(17)16(19)18-3-4-25-5-6-26-7-8-27-9-10-28(20,21)22/h14-15H,3-13,17H2,1-2H3,(H,18,19)(H2,20,21,22)/t14-,15+/m1/s1 |
| InChIKey | DWNXMWHLVPCMCM-CABCVRRESA-N |
| XLogP | -0.95 |
| TPSA | 158.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|