C17H32N2O7S — CID 123740526
[2-acetyloxy-3-[2-amino-3-oxo-3-[2-(2-propoxyethoxy)ethylamino]propyl]sulfanylpropyl] acetate (PubChem CID 123740526) has the molecular formula C17H32N2O7S and a molecular weight of 408.52 g/mol. Its IUPAC name is [2-acetyloxy-3-[2-amino-3-oxo-3-[2-(2-propoxyethoxy)ethylamino]propyl]sulfanylpropyl] acetate.
| Compound Name | [2-acetyloxy-3-[2-amino-3-oxo-3-[2-(2-propoxyethoxy)ethylamino]propyl]sulfanylpropyl] acetate |
|---|---|
| PubChem CID | 123740526 |
| Molecular Formula | C17H32N2O7S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | [2-acetyloxy-3-[2-amino-3-oxo-3-[2-(2-propoxyethoxy)ethylamino]propyl]sulfanylpropyl] acetate |
| SMILES | CCCOCCOCCNC(=O)C(N)CSCC(COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C17H32N2O7S/c1-4-6-23-8-9-24-7-5-19-17(22)16(18)12-27-11-15(26-14(3)21)10-25-13(2)20/h15-16H,4-12,18H2,1-3H3,(H,19,22) |
| InChIKey | CXWLNBBTWCVMDK-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|