C15H27F2N2O9PS — CID 123581187
[3-[2-[[2-amino-3-(2,3-diacetyloxypropylsulfanyl)propanoyl]amino]ethoxy]-1,1-difluoropropyl]phosphonic acid (PubChem CID 123581187) has the molecular formula C15H27F2N2O9PS and a molecular weight of 480.42 g/mol. Its IUPAC name is [3-[2-[[2-amino-3-(2,3-diacetyloxypropylsulfanyl)propanoyl]amino]ethoxy]-1,1-difluoropropyl]phosphonic acid.
| Compound Name | [3-[2-[[2-amino-3-(2,3-diacetyloxypropylsulfanyl)propanoyl]amino]ethoxy]-1,1-difluoropropyl]phosphonic acid |
|---|---|
| PubChem CID | 123581187 |
| Molecular Formula | C15H27F2N2O9PS |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | [3-[2-[[2-amino-3-(2,3-diacetyloxypropylsulfanyl)propanoyl]amino]ethoxy]-1,1-difluoropropyl]phosphonic acid |
| SMILES | CC(=O)OCC(CSCC(N)C(=O)NCCOCCC(F)(F)P(=O)(O)O)OC(C)=O |
| InChI | InChI=1S/C15H27F2N2O9PS/c1-10(20)27-7-12(28-11(2)21)8-30-9-13(18)14(22)19-4-6-26-5-3-15(16,17)29(23,24)25/h12-13H,3-9,18H2,1-2H3,(H,19,22)(H2,23,24,25) |
| InChIKey | QSVFVFNMYAPRAH-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 174.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|