C18H33F2N2O8PS — CID 123650407
[4-[[3-[3-acetyloxy-2-(3-methylpentanoyloxy)propyl]sulfanyl-2-aminopropanoyl]amino]-1,1-difluorobutyl]phosphonic acid (PubChem CID 123650407) has the molecular formula C18H33F2N2O8PS and a molecular weight of 506.51 g/mol. Its IUPAC name is [4-[[3-[3-acetyloxy-2-(3-methylpentanoyloxy)propyl]sulfanyl-2-aminopropanoyl]amino]-1,1-difluorobutyl]phosphonic acid.
| Compound Name | [4-[[3-[3-acetyloxy-2-(3-methylpentanoyloxy)propyl]sulfanyl-2-aminopropanoyl]amino]-1,1-difluorobutyl]phosphonic acid |
|---|---|
| PubChem CID | 123650407 |
| Molecular Formula | C18H33F2N2O8PS |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | [4-[[3-[3-acetyloxy-2-(3-methylpentanoyloxy)propyl]sulfanyl-2-aminopropanoyl]amino]-1,1-difluorobutyl]phosphonic acid |
| SMILES | CCC(C)CC(=O)OC(COC(C)=O)CSCC(N)C(=O)NCCCC(F)(F)P(=O)(O)O |
| InChI | InChI=1S/C18H33F2N2O8PS/c1-4-12(2)8-16(24)30-14(9-29-13(3)23)10-32-11-15(21)17(25)22-7-5-6-18(19,20)31(26,27)28/h12,14-15H,4-11,21H2,1-3H3,(H,22,25)(H2,26,27,28) |
| InChIKey | MKMGCOSWQHONBL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 165.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|