C18H33N2O12P — CID 174184622
[2-[(3R)-3-aminobutanoyl]oxy-3-[[(2R)-2,3-diacetyloxypropoxy]-hydroxyphosphoryl]oxypropyl] (3R)-3-aminobutanoate (PubChem CID 174184622) has the molecular formula C18H33N2O12P and a molecular weight of 500.44 g/mol. Its IUPAC name is [2-[(3R)-3-aminobutanoyl]oxy-3-[[(2R)-2,3-diacetyloxypropoxy]-hydroxyphosphoryl]oxypropyl] (3R)-3-aminobutanoate.
| Compound Name | [2-[(3R)-3-aminobutanoyl]oxy-3-[[(2R)-2,3-diacetyloxypropoxy]-hydroxyphosphoryl]oxypropyl] (3R)-3-aminobutanoate |
|---|---|
| PubChem CID | 174184622 |
| Molecular Formula | C18H33N2O12P |
| Molecular Weight | 500.44 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | [2-[(3R)-3-aminobutanoyl]oxy-3-[[(2R)-2,3-diacetyloxypropoxy]-hydroxyphosphoryl]oxypropyl] (3R)-3-aminobutanoate |
| SMILES | CC(=O)OC[C@H](COP(=O)(O)OCC(COC(=O)C[C@@H](C)N)OC(=O)C[C@@H](C)N)OC(C)=O |
| InChI | InChI=1S/C18H33N2O12P/c1-11(19)5-17(23)28-8-16(32-18(24)6-12(2)20)10-30-33(25,26)29-9-15(31-14(4)22)7-27-13(3)21/h11-12,15-16H,5-10,19-20H2,1-4H3,(H,25,26)/t11-,12-,15-,16?/m1/s1 |
| InChIKey | RMCUVMGWAJIYCI-YRPHPIRKSA-N |
| XLogP | -0.46 |
| TPSA | 213.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.44 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|