C20H37N2O12P — CID 174184623
[3-[[(2R)-2,3-diacetyloxypropoxy]-hydroxyphosphoryl]oxy-2-[3-(dimethylamino)propanoyloxy]propyl] 3-(dimethylamino)propanoate (PubChem CID 174184623) has the molecular formula C20H37N2O12P and a molecular weight of 528.49 g/mol. Its IUPAC name is [3-[[(2R)-2,3-diacetyloxypropoxy]-hydroxyphosphoryl]oxy-2-[3-(dimethylamino)propanoyloxy]propyl] 3-(dimethylamino)propanoate.
| Compound Name | [3-[[(2R)-2,3-diacetyloxypropoxy]-hydroxyphosphoryl]oxy-2-[3-(dimethylamino)propanoyloxy]propyl] 3-(dimethylamino)propanoate |
|---|---|
| PubChem CID | 174184623 |
| Molecular Formula | C20H37N2O12P |
| Molecular Weight | 528.49 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | [3-[[(2R)-2,3-diacetyloxypropoxy]-hydroxyphosphoryl]oxy-2-[3-(dimethylamino)propanoyloxy]propyl] 3-(dimethylamino)propanoate |
| SMILES | CC(=O)OC[C@H](COP(=O)(O)OCC(COC(=O)CCN(C)C)OC(=O)CCN(C)C)OC(C)=O |
| InChI | InChI=1S/C20H37N2O12P/c1-15(23)29-11-17(33-16(2)24)13-31-35(27,28)32-14-18(34-20(26)8-10-22(5)6)12-30-19(25)7-9-21(3)4/h17-18H,7-14H2,1-6H3,(H,27,28)/t17-,18?/m1/s1 |
| InChIKey | ODCZVGOLCZOIJQ-QNSVNVJESA-N |
| XLogP | -0.03 |
| TPSA | 167.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.49 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|