C18H27O16P — CID 174184640
4-[2-(3-carboxypropanoyloxy)-3-[[(2R)-2,3-diacetyloxypropoxy]-hydroxyphosphoryl]oxypropoxy]-4-oxobutanoic acid (PubChem CID 174184640) has the molecular formula C18H27O16P and a molecular weight of 530.37 g/mol. Its IUPAC name is 4-[2-(3-carboxypropanoyloxy)-3-[[(2R)-2,3-diacetyloxypropoxy]-hydroxyphosphoryl]oxypropoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-(3-carboxypropanoyloxy)-3-[[(2R)-2,3-diacetyloxypropoxy]-hydroxyphosphoryl]oxypropoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 174184640 |
| Molecular Formula | C18H27O16P |
| Molecular Weight | 530.37 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | 4-[2-(3-carboxypropanoyloxy)-3-[[(2R)-2,3-diacetyloxypropoxy]-hydroxyphosphoryl]oxypropoxy]-4-oxobutanoic acid |
| SMILES | CC(=O)OC[C@H](COP(=O)(O)OCC(COC(=O)CCC(=O)O)OC(=O)CCC(=O)O)OC(C)=O |
| InChI | InChI=1S/C18H27O16P/c1-11(19)29-7-13(33-12(2)20)9-31-35(27,28)32-10-14(34-18(26)6-4-16(23)24)8-30-17(25)5-3-15(21)22/h13-14H,3-10H2,1-2H3,(H,21,22)(H,23,24)(H,27,28)/t13-,14?/m1/s1 |
| InChIKey | QLIGVVHNQOIWAL-KWCCSABGSA-N |
| XLogP | -0.20 |
| TPSA | 235.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.37 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|