C9H19N2O8P — CID 135291453
[2-acetyloxy-3-[2-hydrazinylethoxy(hydroxy)phosphoryl]oxypropyl] acetate (PubChem CID 135291453) has the molecular formula C9H19N2O8P and a molecular weight of 314.23 g/mol. Its IUPAC name is [2-acetyloxy-3-[2-hydrazinylethoxy(hydroxy)phosphoryl]oxypropyl] acetate.
| Compound Name | [2-acetyloxy-3-[2-hydrazinylethoxy(hydroxy)phosphoryl]oxypropyl] acetate |
|---|---|
| PubChem CID | 135291453 |
| Molecular Formula | C9H19N2O8P |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | [2-acetyloxy-3-[2-hydrazinylethoxy(hydroxy)phosphoryl]oxypropyl] acetate |
| SMILES | CC(=O)OCC(COP(=O)(O)OCCNN)OC(C)=O |
| InChI | InChI=1S/C9H19N2O8P/c1-7(12)16-5-9(19-8(2)13)6-18-20(14,15)17-4-3-11-10/h9,11H,3-6,10H2,1-2H3,(H,14,15) |
| InChIKey | SLCGMSQIFXVFFE-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 146.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|