C15H27O9P — CID 58331137
[(2S)-3-[hydroxy(4-oxopentoxy)phosphoryl]oxy-2-(4-oxopentoxy)propyl] acetate (PubChem CID 58331137) has the molecular formula C15H27O9P and a molecular weight of 382.35 g/mol. Its IUPAC name is [(2S)-3-[hydroxy(4-oxopentoxy)phosphoryl]oxy-2-(4-oxopentoxy)propyl] acetate.
| Compound Name | [(2S)-3-[hydroxy(4-oxopentoxy)phosphoryl]oxy-2-(4-oxopentoxy)propyl] acetate |
|---|---|
| PubChem CID | 58331137 |
| Molecular Formula | C15H27O9P |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | [(2S)-3-[hydroxy(4-oxopentoxy)phosphoryl]oxy-2-(4-oxopentoxy)propyl] acetate |
| SMILES | CC(=O)CCCO[C@@H](COC(C)=O)COP(=O)(O)OCCCC(C)=O |
| InChI | InChI=1S/C15H27O9P/c1-12(16)6-4-8-21-15(10-22-14(3)18)11-24-25(19,20)23-9-5-7-13(2)17/h15H,4-11H2,1-3H3,(H,19,20)/t15-/m0/s1 |
| InChIKey | RLZHWQBIEOECMJ-HNNXBMFYSA-N |
| XLogP | 1.81 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|