C25H54NO6P — CID 175554203
2-aminoethyl 2,3-didecoxypropyl hydrogen phosphate (PubChem CID 175554203) has the molecular formula C25H54NO6P and a molecular weight of 495.68 g/mol. Its IUPAC name is 2-aminoethyl 2,3-didecoxypropyl hydrogen phosphate.
| Compound Name | 2-aminoethyl 2,3-didecoxypropyl hydrogen phosphate |
|---|---|
| PubChem CID | 175554203 |
| Molecular Formula | C25H54NO6P |
| Molecular Weight | 495.68 g/mol |
| Exact Mass | 495.37 |
| IUPAC Name | 2-aminoethyl 2,3-didecoxypropyl hydrogen phosphate |
| SMILES | CCCCCCCCCCOCC(COP(=O)(O)OCCN)OCCCCCCCCCC |
| InChI | InChI=1S/C25H54NO6P/c1-3-5-7-9-11-13-15-17-20-29-23-25(24-32-33(27,28)31-22-19-26)30-21-18-16-14-12-10-8-6-4-2/h25H,3-24,26H2,1-2H3,(H,27,28) |
| InChIKey | XNYBTRRDRDPQMK-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.68 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|