C14H26N2O6 — CID 58729864
[3-(ethylcarbamoyloxy)-2-(4-oxopentoxy)propyl] N-ethylcarbamate (PubChem CID 58729864) has the molecular formula C14H26N2O6 and a molecular weight of 318.37 g/mol. Its IUPAC name is [3-(ethylcarbamoyloxy)-2-(4-oxopentoxy)propyl] N-ethylcarbamate.
| Compound Name | [3-(ethylcarbamoyloxy)-2-(4-oxopentoxy)propyl] N-ethylcarbamate |
|---|---|
| PubChem CID | 58729864 |
| Molecular Formula | C14H26N2O6 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | [3-(ethylcarbamoyloxy)-2-(4-oxopentoxy)propyl] N-ethylcarbamate |
| SMILES | CCNC(=O)OCC(COC(=O)NCC)OCCCC(C)=O |
| InChI | InChI=1S/C14H26N2O6/c1-4-15-13(18)21-9-12(10-22-14(19)16-5-2)20-8-6-7-11(3)17/h12H,4-10H2,1-3H3,(H,15,18)(H,16,19) |
| InChIKey | DJGBSEDPLVWASY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|