C15H30N3O7V- — CID 163544048
[2-(5-aminooxy-4-oxopentoxy)-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate;carbanide;vanadium (PubChem CID 163544048) has the molecular formula C15H30N3O7V- and a molecular weight of 415.36 g/mol. Its IUPAC name is [2-(5-aminooxy-4-oxopentoxy)-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate;carbanide;vanadium.
| Compound Name | [2-(5-aminooxy-4-oxopentoxy)-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate;carbanide;vanadium |
|---|---|
| PubChem CID | 163544048 |
| Molecular Formula | C15H30N3O7V- |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | [2-(5-aminooxy-4-oxopentoxy)-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate;carbanide;vanadium |
| SMILES | CCNC(=O)OCC(COC(=O)NCC)OCCCC(=O)CON.[CH3-].[V] |
| InChI | InChI=1S/C14H27N3O7.CH3.V/c1-3-16-13(19)22-9-12(10-23-14(20)17-4-2)21-7-5-6-11(18)8-24-15;;/h12H,3-10,15H2,1-2H3,(H,16,19)(H,17,20);1H3;/q;-1; |
| InChIKey | QKGCXJSYSLXFPS-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 138.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|