C13H22N2O7 — CID 100978128
2,3-bis(ethylcarbamoyloxy)propyl 2-oxobutanoate (PubChem CID 100978128) has the molecular formula C13H22N2O7 and a molecular weight of 318.33 g/mol. Its IUPAC name is 2,3-bis(ethylcarbamoyloxy)propyl 2-oxobutanoate.
| Compound Name | 2,3-bis(ethylcarbamoyloxy)propyl 2-oxobutanoate |
|---|---|
| PubChem CID | 100978128 |
| Molecular Formula | C13H22N2O7 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 2,3-bis(ethylcarbamoyloxy)propyl 2-oxobutanoate |
| SMILES | CCNC(=O)OCC(COC(=O)C(=O)CC)OC(=O)NCC |
| InChI | InChI=1S/C13H22N2O7/c1-4-10(16)11(17)20-7-9(22-13(19)15-6-3)8-21-12(18)14-5-2/h9H,4-8H2,1-3H3,(H,14,18)(H,15,19) |
| InChIKey | LKYQWFXOGMRROB-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|