C9H18N2O5 — CID 59021341
[3-ethoxy-2-(methylcarbamoyloxy)propyl] N-methylcarbamate (PubChem CID 59021341) has the molecular formula C9H18N2O5 and a molecular weight of 234.25 g/mol. Its IUPAC name is [3-ethoxy-2-(methylcarbamoyloxy)propyl] N-methylcarbamate.
| Compound Name | [3-ethoxy-2-(methylcarbamoyloxy)propyl] N-methylcarbamate |
|---|---|
| PubChem CID | 59021341 |
| Molecular Formula | C9H18N2O5 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | [3-ethoxy-2-(methylcarbamoyloxy)propyl] N-methylcarbamate |
| SMILES | CCOCC(COC(=O)NC)OC(=O)NC |
| InChI | InChI=1S/C9H18N2O5/c1-4-14-5-7(16-9(13)11-3)6-15-8(12)10-2/h7H,4-6H2,1-3H3,(H,10,12)(H,11,13) |
| InChIKey | CSIGZHHUPWQTQV-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |