C15H30N2O5 — CID 59499826
[2-(butylcarbamoyloxy)-3-ethoxypropyl] N-butylcarbamate (PubChem CID 59499826) has the molecular formula C15H30N2O5 and a molecular weight of 318.41 g/mol. Its IUPAC name is [2-(butylcarbamoyloxy)-3-ethoxypropyl] N-butylcarbamate.
| Compound Name | [2-(butylcarbamoyloxy)-3-ethoxypropyl] N-butylcarbamate |
|---|---|
| PubChem CID | 59499826 |
| Molecular Formula | C15H30N2O5 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | [2-(butylcarbamoyloxy)-3-ethoxypropyl] N-butylcarbamate |
| SMILES | CCCCNC(=O)OCC(COCC)OC(=O)NCCCC |
| InChI | InChI=1S/C15H30N2O5/c1-4-7-9-16-14(18)21-12-13(11-20-6-3)22-15(19)17-10-8-5-2/h13H,4-12H2,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | NRYHGIMVGUGLBU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|