C12H25NO5 — CID 59185255
2,3-dimethoxypropyl N-(3-propoxypropyl)carbamate (PubChem CID 59185255) has the molecular formula C12H25NO5 and a molecular weight of 263.33 g/mol. Its IUPAC name is 2,3-dimethoxypropyl N-(3-propoxypropyl)carbamate.
| Compound Name | 2,3-dimethoxypropyl N-(3-propoxypropyl)carbamate |
|---|---|
| PubChem CID | 59185255 |
| Molecular Formula | C12H25NO5 |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 2,3-dimethoxypropyl N-(3-propoxypropyl)carbamate |
| SMILES | CCCOCCCNC(=O)OCC(COC)OC |
| InChI | InChI=1S/C12H25NO5/c1-4-7-17-8-5-6-13-12(14)18-10-11(16-3)9-15-2/h11H,4-10H2,1-3H3,(H,13,14) |
| InChIKey | NXIVZVBFTNTFNB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|