C15H32N2O6 — CID 157151127
butan-2-one;[3-(ethylcarbamoyloxy)-2-methoxypropyl] N-ethylcarbamate;methane (PubChem CID 157151127) has the molecular formula C15H32N2O6 and a molecular weight of 336.43 g/mol. Its IUPAC name is butan-2-one;[3-(ethylcarbamoyloxy)-2-methoxypropyl] N-ethylcarbamate;methane.
| Compound Name | butan-2-one;[3-(ethylcarbamoyloxy)-2-methoxypropyl] N-ethylcarbamate;methane |
|---|---|
| PubChem CID | 157151127 |
| Molecular Formula | C15H32N2O6 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | butan-2-one;[3-(ethylcarbamoyloxy)-2-methoxypropyl] N-ethylcarbamate;methane |
| SMILES | C.CCC(C)=O.CCNC(=O)OCC(COC(=O)NCC)OC |
| InChI | InChI=1S/C10H20N2O5.C4H8O.CH4/c1-4-11-9(13)16-6-8(15-3)7-17-10(14)12-5-2;1-3-4(2)5;/h8H,4-7H2,1-3H3,(H,11,13)(H,12,14);3H2,1-2H3;1H4 |
| InChIKey | ALGOHYUVHWBNLS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |