C8H16N2O4 — CID 44997787
N'-(2,2-dimethoxyethyl)-N-ethyloxamide (PubChem CID 44997787) has the molecular formula C8H16N2O4 and a molecular weight of 204.23 g/mol. Its IUPAC name is N'-(2,2-dimethoxyethyl)-N-ethyloxamide.
| Compound Name | N'-(2,2-dimethoxyethyl)-N-ethyloxamide |
|---|---|
| PubChem CID | 44997787 |
| Molecular Formula | C8H16N2O4 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | N'-(2,2-dimethoxyethyl)-N-ethyloxamide |
| SMILES | CCNC(=O)C(=O)NCC(OC)OC |
| InChI | InChI=1S/C8H16N2O4/c1-4-9-7(11)8(12)10-5-6(13-2)14-3/h6H,4-5H2,1-3H3,(H,9,11)(H,10,12) |
| InChIKey | LZANBBLMBIJQKT-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|